|
CAS#: 93919-22-3 Product: 2,2'-({4-[(2-Hydroxyethyl)amino]-2-nitrophenyl}imino)diethanol No suppilers available for the product. |
| Name | 2,2'-({4-[(2-Hydroxyethyl)amino]-2-nitrophenyl}imino)diethanol |
|---|---|
| Synonyms | 2,2'-[[4- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 |
| CAS Registry Number | 93919-22-3 |
| EINECS | 300-007-1 |
| SMILES | [O-][N+](=O)c1cc(ccc1N(CCO)CCO)NCCO |
| InChI | 1S/C12H19N3O5/c16-6-3-13-10-1-2-11(12(9-10)15(19)20)14(4-7-17)5-8-18/h1-2,9,13,16-18H,3-8H2 |
| InChIKey | YASCOZNFOIEAHZ-UHFFFAOYSA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.731°C at 760 mmHg (Cal.) |
| Flash point | 297.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-({4-[(2-Hydroxyethyl)amino]-2-nitrophenyl}imino)diethanol |