|
CAS#: 93919-27-8 Product: 2,6-Dichloro-4-Nitroanilinium Chloride No suppilers available for the product. |
| Name | 2,6-Dichloro-4-Nitroanilinium Chloride |
|---|---|
| Synonyms | (2,6-Dichloro-4-Nitro-Phenyl)Ammonium Chloride; (2,6-Dichloro-4-Nitrophenyl)Ammonium Chloride; (2,6-Dichloro-4-Nitro-Phenyl)Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5Cl3N2O2 |
| Molecular Weight | 243.48 |
| CAS Registry Number | 93919-27-8 |
| EINECS | 300-012-9 |
| SMILES | C1=C([N+]([O-])=O)C=C(Cl)C(=C1Cl)[NH3+].[Cl-] |
| InChI | 1S/C6H4Cl2N2O2.ClH/c7-4-1-3(10(11)12)2-5(8)6(4)9;/h1-2H,9H2;1H |
| InChIKey | KBRQVBKMCXVUOC-UHFFFAOYSA-N |
| Boiling point | 323°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 149.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloro-4-Nitroanilinium Chloride |