|
CAS#: 93923-85-4 Product: N2-Formyl-L-Asparagine No suppilers available for the product. |
| Name | N2-Formyl-L-Asparagine |
|---|---|
| Synonyms | (2R)-4-Amino-2-Formamido-4-Oxo-Butanoic Acid; (2R)-4-Amino-2-Formamido-4-Keto-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 |
| CAS Registry Number | 93923-85-4 |
| EINECS | 300-175-6 |
| SMILES | [C@H](C(=O)O)(CC(=O)N)NC=O |
| InChI | 1S/C5H8N2O4/c6-4(9)1-3(5(10)11)7-2-8/h2-3H,1H2,(H2,6,9)(H,7,8)(H,10,11)/t3-/m1/s1 |
| InChIKey | JAVLYLWAJRRFPC-GSVOUGTGSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.713°C at 760 mmHg (Cal.) |
| Flash point | 328.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-Formyl-L-Asparagine |