|
CAS#: 93940-28-4 Product: 3,4,5,6,7,8-Hexahydro-5,5,8,8-Tetramethylanthracen-1(2H)-One No suppilers available for the product. |
| Name | 3,4,5,6,7,8-Hexahydro-5,5,8,8-Tetramethylanthracen-1(2H)-One |
|---|---|
| Synonyms | 3,4,5,6,7,8-Hexahydro-5,5,8,8-Tetramethylanthracen-1(2H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 |
| CAS Registry Number | 93940-28-4 |
| EINECS | 300-422-8 |
| SMILES | C1=C3C(=CC2=C1C(=O)CCC2)C(CCC3(C)C)(C)C |
| InChI | 1S/C18H24O/c1-17(2)8-9-18(3,4)15-11-13-12(10-14(15)17)6-5-7-16(13)19/h10-11H,5-9H2,1-4H3 |
| InChIKey | TUWBVBYVXBXGFD-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.051°C at 760 mmHg (Cal.) |
| Flash point | 158.465°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6,7,8-Hexahydro-5,5,8,8-Tetramethylanthracen-1(2H)-One |