|
CAS#: 93941-78-7 Product: N-Ethylethanaminium 2-(2,4-dichlorophenoxy)propanoate No suppilers available for the product. |
| Name | N-Ethylethanaminium 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| Synonyms | diethylammonium 2-(2,4-dichlorophenoxy)propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19Cl2NO3 |
| Molecular Weight | 308.20 |
| CAS Registry Number | 93941-78-7 |
| EINECS | 300-527-9 |
| SMILES | Clc1cc(Cl)ccc1OC(C)C([O-])=O.CC[NH2+]CC |
| InChI | 1S/C9H8Cl2O3.C4H11N/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;1-3-5-4-2/h2-5H,1H3,(H,12,13);5H,3-4H2,1-2H3 |
| InChIKey | NLGJPPMUXJBNTJ-UHFFFAOYSA-N |
| Boiling point | 410°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethylethanaminium 2-(2,4-dichlorophenoxy)propanoate |