Online Database of Chemicals from Around the World
|
CAS#: 93941-82-3 Product: 1,3-Dimethylbutyl 2-(2,4,5-Trichlorophenoxy)Acetate No suppilers available for the product. |
| Name | 1,3-Dimethylbutyl 2-(2,4,5-Trichlorophenoxy)Acetate |
|---|---|
| Synonyms | 1,3-Dimethylbutyl 2-(2,4,5-Trichlorophenoxy)Acetate; 2-(2,4,5-Trichlorophenoxy)Acetic Acid 1,3-Dimethylbutyl Ester; 4-Methylpentan-2-Yl 2-(2,4,5-Trichlorophenoxy)Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C14H17Cl3O3 |
| Molecular Weight | 339.65 |
| CAS Registry Number | 93941-82-3 |
| EINECS | 300-532-6 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC(OC(CC(C)C)C)=O |
| InChI | 1S/C14H17Cl3O3/c1-8(2)4-9(3)20-14(18)7-19-13-6-11(16)10(15)5-12(13)17/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | HIBAPSKFJRQZJG-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.244°C at 760 mmHg (Cal.) |
| Flash point | 139.629°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethylbutyl 2-(2,4,5-Trichlorophenoxy)Acetate |