|
CAS#: 93942-61-1 Product: 1-(2,3-Dichlorophenyl)Ethan-1-One Oxime No suppilers available for the product. |
| Name | 1-(2,3-Dichlorophenyl)Ethan-1-One Oxime |
|---|---|
| Synonyms | 1-(2,3-Dichlorophenyl)Ethanone Oxime; 1-(2,3-Dichlorophenyl)Ethan-1-One Oxime |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 |
| CAS Registry Number | 93942-61-1 |
| EINECS | 300-615-7 |
| SMILES | C1=CC=C(Cl)C(=C1C(=N/O)/C)Cl |
| InChI | 1S/C8H7Cl2NO/c1-5(11-12)6-3-2-4-7(9)8(6)10/h2-4,12H,1H3/b11-5+ |
| InChIKey | RZRLUSUIHLPOJK-VZUCSPMQSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.744°C at 760 mmHg (Cal.) |
| Flash point | 151.41°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,3-Dichlorophenyl)Ethan-1-One Oxime |