Online Database of Chemicals from Around the World
|
CAS#: 93951-24-7 Product: 2-Phenyl-1-(2,4,6-Trimethylbenzoyl)-1H-Imidazole No suppilers available for the product. |
| Name | 2-Phenyl-1-(2,4,6-Trimethylbenzoyl)-1H-Imidazole |
|---|---|
| Synonyms | (2-Phenyl-1-Imidazolyl)-(2,4,6-Trimethylphenyl)Methanone; 2-Phenyl-1-(2,4,6-Trimethylbenzoyl)-1H-Imidazole |
| Molecular Structure |  |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.36 |
| CAS Registry Number | 93951-24-7 |
| EINECS | 300-647-1 |
| SMILES | C1=C(C(=C(C=C1C)C)C(=O)[N]2C(=NC=C2)C3=CC=CC=C3)C |
| InChI | 1S/C19H18N2O/c1-13-11-14(2)17(15(3)12-13)19(22)21-10-9-20-18(21)16-7-5-4-6-8-16/h4-12H,1-3H3 |
| InChIKey | MGNFFUHBTQWOSG-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.54°C at 760 mmHg (Cal.) |
| Flash point | 259.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-1-(2,4,6-Trimethylbenzoyl)-1H-Imidazole |