|
CAS#: 93951-26-9 Product: Tris[2-(methacryloyloxy)ethyl] 5-{[4-(4-aminophenoxy)phenyl]carbamoyl}-1,2,4-benzenetricarboxylate No suppilers available for the product. |
| Name | Tris[2-(methacryloyloxy)ethyl] 5-{[4-(4-aminophenoxy)phenyl]carbamoyl}-1,2,4-benzenetricarboxylate |
|---|---|
| Synonyms | tris[2-[( |
| Molecular Structure | ![]() |
| Molecular Formula | C40H40N2O14 |
| Molecular Weight | 772.75 |
| CAS Registry Number | 93951-26-9 |
| EINECS | 300-649-2 |
| SMILES | CC(=C)C(=O)OCCOC(=O)c1cc(c(cc1C(=O)OCCOC(=O)C(C)=C)C(=O)OCCOC(=O)C(C)=C)C(=O)Nc3ccc(Oc2ccc(N)cc2)cc3 |
| InChI | 1S/C40H40N2O14/c1-23(2)35(44)50-15-18-53-38(47)31-22-33(40(49)55-20-17-52-37(46)25(5)6)32(39(48)54-19-16-51-36(45)24(3)4)21-30(31)34(43)42-27-9-13-29(14-10-27)56-28-11-7-26(41)8-12-28/h7-14,21-22H,1,3,5,15-20,41H2,2,4,6H3,(H,42,43) |
| InChIKey | YFJHYYOIUUAIFS-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 820.548°C at 760 mmHg (Cal.) |
| Flash point | 450.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris[2-(methacryloyloxy)ethyl] 5-{[4-(4-aminophenoxy)phenyl]carbamoyl}-1,2,4-benzenetricarboxylate |