Online Database of Chemicals from Around the World
|
CAS#: 93963-98-5 Product: 2,10-Dipropionyl-10H-Phenothiazine No suppilers available for the product. |
| Name | 2,10-Dipropionyl-10H-Phenothiazine |
|---|---|
| Synonyms | 1-[2-(1-Oxopropyl)-10-Phenothiazinyl]Propan-1-One; 1-(2-Propionylphenothiazin-10-Yl)Propan-1-One; Oprea1_375997 |
| Molecular Structure |  |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.40 |
| CAS Registry Number | 93963-98-5 |
| EINECS | 300-844-2 |
| SMILES | C1=C(C=CC2=C1N(C3=C(S2)C=CC=C3)C(=O)CC)C(=O)CC |
| InChI | 1S/C18H17NO2S/c1-3-15(20)12-9-10-17-14(11-12)19(18(21)4-2)13-7-5-6-8-16(13)22-17/h5-11H,3-4H2,1-2H3 |
| InChIKey | INBFDIYBWKUJRJ-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.171°C at 760 mmHg (Cal.) |
| Flash point | 301.653°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,10-Dipropionyl-10H-Phenothiazine |