|
CAS#: 93964-68-2 Product: 3-[5-(Dibenzylamino)-2-methoxyphenyl]-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1(3H)-one No suppilers available for the product. |
| Name | 3-[5-(Dibenzylamino)-2-methoxyphenyl]-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1(3H)-one |
|---|---|
| Synonyms | 3-(5-dibe |
| Molecular Structure | ![]() |
| Molecular Formula | C39H38N2O4 |
| Molecular Weight | 598.73 |
| CAS Registry Number | 93964-68-2 |
| EINECS | 300-914-2 |
| SMILES | CCN(CC)c1ccc(c(O)c1)C3(OC(=O)c2ccccc23)c4cc(ccc4OC)N(Cc5ccccc5)Cc6ccccc6 |
| InChI | 1S/C39H38N2O4/c1-4-40(5-2)31-20-22-34(36(42)25-31)39(33-19-13-12-18-32(33)38(43)45-39)35-24-30(21-23-37(35)44-3)41(26-28-14-8-6-9-15-28)27-29-16-10-7-11-17-29/h6-25,42H,4-5,26-27H2,1-3H3 |
| InChIKey | BPJOLTSOXBQBAZ-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 809.062°C at 760 mmHg (Cal.) |
| Flash point | 443.105°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[5-(Dibenzylamino)-2-methoxyphenyl]-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1(3H)-one |