|
CAS#: 93965-10-7 Product: 2-(2,4-Dichlorophenoxy)Propan-2-Ol No suppilers available for the product. |
| Name | 2-(2,4-Dichlorophenoxy)Propan-2-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 |
| CAS Registry Number | 93965-10-7 |
| EINECS | 300-958-2 |
| SMILES | C1=C(Cl)C=CC(=C1Cl)OC(O)(C)C |
| InChI | 1S/C9H10Cl2O2/c1-9(2,12)13-8-4-3-6(10)5-7(8)11/h3-5,12H,1-2H3 |
| InChIKey | FWMAWTRDKYQUNE-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.99°C at 760 mmHg (Cal.) |
| Flash point | 140.673°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenoxy)Propan-2-Ol |