|
CAS#: 93966-60-0 Product: Bis[2-[[4-[(2-Chloro-4-Nitrophenyl)Azo]Phenyl]Ethylamino]Ethyl] Azelate No suppilers available for the product. |
| Name | Bis[2-[[4-[(2-Chloro-4-Nitrophenyl)Azo]Phenyl]Ethylamino]Ethyl] Azelate |
|---|---|
| Synonyms | bis[2-[[4 |
| Molecular Structure | ![]() |
| Molecular Formula | C41H46Cl2N8O8 |
| Molecular Weight | 849.76 |
| CAS Registry Number | 93966-60-0 |
| EINECS | 301-012-1 |
| SMILES | Clc4cc(ccc4N=Nc1ccc(cc1)N(CC)CCOC(=O)CCCCCCCC(=O)OCCN(CC)c3ccc(N=Nc2ccc(cc2Cl)[N+]([O-])=O)cc3)[N+]([O-])=O |
| InChI | 1S/C41H46Cl2N8O8/c1-3-48(32-16-12-30(13-17-32)44-46-38-22-20-34(50(54)55)28-36(38)42)24-26-58-40(52)10-8-6-5-7-9-11-41(53)59-27-25-49(4-2)33-18-14-31(15-19-33)45-47-39-23-21-35(51(56)57)29-37(39)43/h12-23,28-29H,3-11,24-27H2,1-2H3 |
| InChIKey | UJECUQTYPLKBCF-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 903.067°C at 760 mmHg (Cal.) |
| Flash point | 499.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[2-[[4-[(2-Chloro-4-Nitrophenyl)Azo]Phenyl]Ethylamino]Ethyl] Azelate |