|
CAS#: 939760-96-0 Product: 3-Nitro-6,7-dihydro-5H-benzo[7]annulene No suppilers available for the product. |
| Name | 3-Nitro-6,7-dihydro-5H-benzo[7]annulene |
|---|---|
| Synonyms | 3-Nitro-6,7-dihydro-5h-benzocycloheptene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 |
| CAS Registry Number | 939760-96-0 |
| SMILES | [O-][N+](=O)c2cc1c(\C=C/CCC1)cc2 |
| InChI | 1S/C11H11NO2/c13-12(14)11-7-6-9-4-2-1-3-5-10(9)8-11/h2,4,6-8H,1,3,5H2 |
| InChIKey | IMGQDYNEIBCUDQ-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.578°C at 760 mmHg (Cal.) |
| Flash point | 151.27°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-6,7-dihydro-5H-benzo[7]annulene |