|
CAS#: 93980-96-2 Product: N-[[4-(Ethylsulphonyl)Phenyl]Benzyl]-1-Methylpyrrolidine-2-Methylamine No suppilers available for the product. |
| Name | N-[[4-(Ethylsulphonyl)Phenyl]Benzyl]-1-Methylpyrrolidine-2-Methylamine |
|---|---|
| Synonyms | 1-(4-Ethylsulfonylphenyl)-N-Methyl-1-Phenyl-N-(2-Pyrrolidinylmethyl)Methanamine; [(4-Ethylsulfonylphenyl)-Phenyl-Methyl]-Methyl-(Pyrrolidin-2-Ylmethyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.52 |
| CAS Registry Number | 93980-96-2 |
| EINECS | 301-077-6 |
| SMILES | C3=C(C(N(CC1NCCC1)C)C2=CC=CC=C2)C=CC(=C3)[S](=O)(=O)CC |
| InChI | 1S/C21H28N2O2S/c1-3-26(24,25)20-13-11-18(12-14-20)21(17-8-5-4-6-9-17)23(2)16-19-10-7-15-22-19/h4-6,8-9,11-14,19,21-22H,3,7,10,15-16H2,1-2H3 |
| InChIKey | MHJCAZAFKBAHET-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.968°C at 760 mmHg (Cal.) |
| Flash point | 264.638°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[[4-(Ethylsulphonyl)Phenyl]Benzyl]-1-Methylpyrrolidine-2-Methylamine |