|
CAS#: 93982-34-4 Product: 4-Amino-1-hydroxy-2-phenoxy-9,10-anthraquinone No suppilers available for the product. |
| Name | 4-Amino-1-hydroxy-2-phenoxy-9,10-anthraquinone |
|---|---|
| Synonyms | 4-amino-1-hydroxy-2-phenoxyanthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H13NO4 |
| Molecular Weight | 331.32 |
| CAS Registry Number | 93982-34-4 |
| EINECS | 301-223-9 |
| SMILES | O=C2c1ccccc1C(=O)c4c2c(N)cc(Oc3ccccc3)c4O |
| InChI | 1S/C20H13NO4/c21-14-10-15(25-11-6-2-1-3-7-11)20(24)17-16(14)18(22)12-8-4-5-9-13(12)19(17)23/h1-10,24H,21H2 |
| InChIKey | YUTGHDCQYGHVNW-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.716°C at 760 mmHg (Cal.) |
| Flash point | 290.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-1-hydroxy-2-phenoxy-9,10-anthraquinone |