|
CAS#: 93983-08-5 Product: N,N'-Bis(Bromophenyl)Guanidine Monohydrochloride No suppilers available for the product. |
| Name | N,N'-Bis(Bromophenyl)Guanidine Monohydrochloride |
|---|---|
| Synonyms | N,N'-Bis(Bromophenyl)Guanidine Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12Br2ClN3 |
| Molecular Weight | 405.52 |
| CAS Registry Number | 93983-08-5 |
| EINECS | 301-296-7 |
| SMILES | [H+].C2=C(NC(=NC1=CC=CC=C1Br)N)C(=CC=C2)Br.[Cl-] |
| InChI | 1S/C13H11Br2N3.ClH/c14-9-5-1-3-7-11(9)17-13(16)18-12-8-4-2-6-10(12)15;/h1-8H,(H3,16,17,18);1H |
| InChIKey | XAEXCQIEPLOBIN-UHFFFAOYSA-N |
| Boiling point | 458.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 231.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(Bromophenyl)Guanidine Monohydrochloride |