|
CAS#: 94-73-5 Product: 9-(1-Cyclopentenyl)purin-6-amine No suppilers available for the product. |
| Name | 9-(1-Cyclopentenyl)purin-6-amine |
|---|---|
| Synonyms | 9-(1-Cyclopentenyl)-6-Purinamine; [9-(1-Cyclopentenyl)Purin-6-Yl]Amine; 9-(Cyclopentenyl)-Adenine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 |
| CAS Registry Number | 94-73-5 |
| SMILES | C2=NC1=C(N=CN=C1[N]2C3=CCCC3)N |
| InChI | 1S/C10H11N5/c11-9-8-10(13-5-12-9)15(6-14-8)7-3-1-2-4-7/h3,5-6H,1-2,4H2,(H2,11,12,13) |
| InChIKey | LLGPVZKAHQNCMY-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.759°C at 760 mmHg (Cal.) |
| Flash point | 228.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(1-Cyclopentenyl)purin-6-amine |