|
CAS#: 94-83-7 Product: 2-(2,4-Dichlorophenoxy)ethyl benzoate No suppilers available for the product. |
| Name | 2-(2,4-Dichlorophenoxy)ethyl benzoate |
|---|---|
| Synonyms | Benzoic Acid 2-(2,4-Dichlorophenoxy)Ethyl Ester; 4-09-00-00355 (Beilstein Handbook Reference); Brn 3382317 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 |
| CAS Registry Number | 94-83-7 |
| EINECS | 202-367-4 |
| SMILES | C1=C(C(=CC(=C1)Cl)Cl)OCCOC(C2=CC=CC=C2)=O |
| InChI | 1S/C15H12Cl2O3/c16-12-6-7-14(13(17)10-12)19-8-9-20-15(18)11-4-2-1-3-5-11/h1-7,10H,8-9H2 |
| InChIKey | LGURYBCSJPXHTF-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.216°C at 760 mmHg (Cal.) |
| Flash point | 170.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenoxy)ethyl benzoate |