|
CAS#: 940-14-7 Product: (4-Nitrophenyl)vinyl ether No suppilers available for the product. |
| Name | (4-Nitrophenyl)vinyl ether |
|---|---|
| Synonyms | 1-Ethenoxy-4-Nitro-Benzene; (4-Nitrophenyl)Vinyl Ether; 1-(Ethenyloxy)-4-Nitrobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 |
| CAS Registry Number | 940-14-7 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)OC=C |
| InChI | 1S/C8H7NO3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h2-6H,1H2 |
| InChIKey | XTVUXNLJQRWUBD-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.889°C at 760 mmHg (Cal.) |
| Flash point | 124.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Nitrophenyl)vinyl ether |