|
CAS#: 94005-97-7 Product: Isobutylammonium Isobutyrate No suppilers available for the product. |
| Name | Isobutylammonium Isobutyrate |
|---|---|
| Synonyms | Isobutylammonium; 2-Methylpropanoate; Isobutylammonium Isobutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 |
| CAS Registry Number | 94005-97-7 |
| EINECS | 301-333-7 |
| SMILES | CC(C([O-])=O)C.C([NH3+])C(C)C |
| InChI | 1S/C4H11N.C4H8O2/c1-4(2)3-5;1-3(2)4(5)6/h4H,3,5H2,1-2H3;3H,1-2H3,(H,5,6) |
| InChIKey | XCQOQTXTVHAEHP-UHFFFAOYSA-N |
| Boiling point | 155.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 58.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobutylammonium Isobutyrate |