|
CAS#: 94006-05-0 Product: Ethyl N-[(3alpha,7alpha,12alpha)-3,7,12-trihydroxy-24-oxocholan-24-yl]glycinate No suppilers available for the product. |
| Name | Ethyl N-[(3alpha,7alpha,12alpha)-3,7,12-trihydroxy-24-oxocholan-24-yl]glycinate |
|---|---|
| Synonyms | ethyl N-[ |
| Molecular Structure | ![]() |
| Molecular Formula | C28H47NO6 |
| Molecular Weight | 493.68 |
| CAS Registry Number | 94006-05-0 |
| EINECS | 301-341-0 |
| SMILES | CCOC(=O)CNC(=O)CC[C@@H](C)[C@H]2CC[C@H]3[C@@H]4[C@H](O)CC1C[C@H](O)CC[C@]1(C)[C@H]4C[C@H](O)[C@]23C |
| InChI | 1S/C28H47NO6/c1-5-35-25(34)15-29-24(33)9-6-16(2)19-7-8-20-26-21(14-23(32)28(19,20)4)27(3)11-10-18(30)12-17(27)13-22(26)31/h16-23,26,30-32H,5-15H2,1-4H3,(H,29,33)/t16-,17?,18-,19-,20+,21+,22-,23+,26+,27+,28-/m1/s1 |
| InChIKey | IUMZSPQFQUFAHS-CWDNZPLVSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 652.567°C at 760 mmHg (Cal.) |
| Flash point | 348.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-[(3alpha,7alpha,12alpha)-3,7,12-trihydroxy-24-oxocholan-24-yl]glycinate |