|
CAS#: 94022-22-7 Product: 2,3,6-Triisopropyl-5-methylphenol No suppilers available for the product. |
| Name | 2,3,6-Triisopropyl-5-methylphenol |
|---|---|
| Synonyms | 2,5,6-triisopropyl-m-cresol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 94022-22-7 |
| EINECS | 301-517-7 |
| SMILES | CC(C)c1c(cc(C)c(C(C)C)c1O)C(C)C |
| InChI | 1S/C16H26O/c1-9(2)13-8-12(7)14(10(3)4)16(17)15(13)11(5)6/h8-11,17H,1-7H3 |
| InChIKey | OHWKAUYBGVQXAX-UHFFFAOYSA-N |
| Density | 0.921g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.784°C at 760 mmHg (Cal.) |
| Flash point | 140.361°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Triisopropyl-5-methylphenol |