|
CAS#: 94022-67-0 Product: Ethyl 2-[4-(1,1-Dimethylethyl)Phenoxy]Propionate No suppilers available for the product. |
| Name | Ethyl 2-[4-(1,1-Dimethylethyl)Phenoxy]Propionate |
|---|---|
| Synonyms | 2-(4-Tert-Butylphenoxy)Propanoic Acid Ethyl Ester; 2-(4-Tert-Butylphenoxy)Propionic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 94022-67-0 |
| EINECS | 301-565-9 |
| SMILES | C1=C(OC(C(OCC)=O)C)C=CC(=C1)C(C)(C)C |
| InChI | 1S/C15H22O3/c1-6-17-14(16)11(2)18-13-9-7-12(8-10-13)15(3,4)5/h7-11H,6H2,1-5H3 |
| InChIKey | VGBZYLBDLXGDJR-UHFFFAOYSA-N |
| Density | 1.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.52°C at 760 mmHg (Cal.) |
| Flash point | 132.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-[4-(1,1-Dimethylethyl)Phenoxy]Propionate |