|
CAS#: 94023-72-0 Product: 4-[2-(4-Carboxyphenoxy)Ethoxy]-3-Chlorobenzoic Acid No suppilers available for the product. |
| Name | 4-[2-(4-Carboxyphenoxy)Ethoxy]-3-Chlorobenzoic Acid |
|---|---|
| Synonyms | 4-[2-(4-Carboxyphenoxy)Ethoxy]-3-Chloro-Benzoic Acid; 4-(2-(4-Carboxyphenoxy)Ethoxy)-3-Chlorobenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13ClO6 |
| Molecular Weight | 336.73 |
| CAS Registry Number | 94023-72-0 |
| EINECS | 301-671-5 |
| SMILES | C1=C(C(=O)O)C=CC(=C1Cl)OCCOC2=CC=C(C(=O)O)C=C2 |
| InChI | 1S/C16H13ClO6/c17-13-9-11(16(20)21)3-6-14(13)23-8-7-22-12-4-1-10(2-5-12)15(18)19/h1-6,9H,7-8H2,(H,18,19)(H,20,21) |
| InChIKey | ZOTIAGGMDTXJIW-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.206°C at 760 mmHg (Cal.) |
| Flash point | 294.417°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(4-Carboxyphenoxy)Ethoxy]-3-Chlorobenzoic Acid |