|
CAS#: 94031-19-3 Product: 3,4-Bis{[(3,5,5-trimethylhexyl)oxy]carbonyl}benzoic acid No suppilers available for the product. |
| Name | 3,4-Bis{[(3,5,5-trimethylhexyl)oxy]carbonyl}benzoic acid |
|---|---|
| Synonyms | bis(3,5,5 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.62 |
| CAS Registry Number | 94031-19-3 |
| EINECS | 301-724-2 |
| SMILES | O=C(OCCC(C)CC(C)(C)C)c1cc(ccc1C(=O)OCCC(C)CC(C)(C)C)C(O)=O |
| InChI | 1S/C27H42O6/c1-18(16-26(3,4)5)11-13-32-24(30)21-10-9-20(23(28)29)15-22(21)25(31)33-14-12-19(2)17-27(6,7)8/h9-10,15,18-19H,11-14,16-17H2,1-8H3,(H,28,29) |
| InChIKey | NBYNKFCKZBVTMQ-UHFFFAOYSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.921°C at 760 mmHg (Cal.) |
| Flash point | 165.654°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Bis{[(3,5,5-trimethylhexyl)oxy]carbonyl}benzoic acid |