Online Database of Chemicals from Around the World
|
CAS#: 94042-96-3 Product: 3,5-Bis(1,1-Dimethylethyl)-N,N-Diethylaniline No suppilers available for the product. |
| Name | 3,5-Bis(1,1-Dimethylethyl)-N,N-Diethylaniline |
|---|---|
| Synonyms | 3,5-Ditert-Butyl-N,N-Diethyl-Aniline; (3,5-Ditert-Butylphenyl)-Diethyl-Amine; 3,5-Bis(1,1-Dimethylethyl)-N,N-Diethylaniline |
| Molecular Structure |  |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 |
| CAS Registry Number | 94042-96-3 |
| EINECS | 301-764-0 |
| SMILES | C1=C(C=C(C=C1C(C)(C)C)N(CC)CC)C(C)(C)C |
| InChI | 1S/C18H31N/c1-9-19(10-2)16-12-14(17(3,4)5)11-15(13-16)18(6,7)8/h11-13H,9-10H2,1-8H3 |
| InChIKey | HERJOAJMXZQYDO-UHFFFAOYSA-N |
| Density | 0.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.987°C at 760 mmHg (Cal.) |
| Flash point | 135.549°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Bis(1,1-Dimethylethyl)-N,N-Diethylaniline |