|
CAS#: 94086-76-7 Product: Isopropyl 4-(4-Nitrophenyl)Butyrate No suppilers available for the product. |
| Name | Isopropyl 4-(4-Nitrophenyl)Butyrate |
|---|---|
| Synonyms | Isopropyl 4-(4-Nitrophenyl)Butanoate; 4-(4-Nitrophenyl)Butanoic Acid Isopropyl Ester; 4-(4-Nitrophenyl)Butyric Acid Isopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 94086-76-7 |
| EINECS | 301-866-5 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)CCCC(OC(C)C)=O |
| InChI | 1S/C13H17NO4/c1-10(2)18-13(15)5-3-4-11-6-8-12(9-7-11)14(16)17/h6-10H,3-5H2,1-2H3 |
| InChIKey | WQUVMYDZSHRUNH-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.093°C at 760 mmHg (Cal.) |
| Flash point | 147.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl 4-(4-Nitrophenyl)Butyrate |