|
CAS#: 94089-12-0 Product: 3-Chloro-N,N-dimethyl-4-{(E)-[2-naphthyl(phenyl)hydrazono]methyl}aniline No suppilers available for the product. |
| Name | 3-Chloro-N,N-dimethyl-4-{(E)-[2-naphthyl(phenyl)hydrazono]methyl}aniline |
|---|---|
| Synonyms | 2-chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C25H22ClN3 |
| Molecular Weight | 399.92 |
| CAS Registry Number | 94089-12-0 |
| EINECS | 302-114-9 |
| SMILES | Clc4cc(ccc4/C=N/N(c1cc2ccccc2cc1)c3ccccc3)N(C)C |
| InChI | 1S/C25H22ClN3/c1-28(2)23-14-13-21(25(26)17-23)18-27-29(22-10-4-3-5-11-22)24-15-12-19-8-6-7-9-20(19)16-24/h3-18H,1-2H3/b27-18+ |
| InChIKey | ATOUEWDTWJYPPQ-OVVQPSECSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.27°C at 760 mmHg (Cal.) |
| Flash point | 305.341°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-N,N-dimethyl-4-{(E)-[2-naphthyl(phenyl)hydrazono]methyl}aniline |