|
CAS#: 94094-49-2 Product: 5'-Methanesulphonamido-2'-Hydroxyacetophenone No suppilers available for the product. |
| Name | 5'-Methanesulphonamido-2'-Hydroxyacetophenone |
|---|---|
| Synonyms | N-(3-Acetyl-4-Hydroxy-Phenyl)Methanesulfonamide; N-(3-Ethanoyl-4-Hydroxy-Phenyl)Methanesulfonamide; N-(3-Acetyl-4-Hydroxyphenyl)Methanesulphonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.25 |
| CAS Registry Number | 94094-49-2 |
| EINECS | 302-151-0 |
| SMILES | C1=C(N[S](=O)(=O)C)C=CC(=C1C(=O)C)O |
| InChI | 1S/C9H11NO4S/c1-6(11)8-5-7(3-4-9(8)12)10-15(2,13)14/h3-5,10,12H,1-2H3 |
| InChIKey | DSQXYAPFBZKYLU-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.74°C at 760 mmHg (Cal.) |
| Flash point | 191.927°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5'-Methanesulphonamido-2'-Hydroxyacetophenone |