|
CAS#: 941-70-8 Product: 2-Carbamoyl-5,5-dimethyl-1,4-hexanedione No suppilers available for the product. |
| Name | 2-Carbamoyl-5,5-dimethyl-1,4-hexanedione |
|---|---|
| Synonyms | 4,4-Dimethyl-2,6-Dioxo-Cyclohexane-1-Carboxamide; 4,4-Dimethyl-2,6-Dioxo-1-Cyclohexanecarboxamide; 2,6-Diketo-4,4-Dimethyl-Cyclohexane-1-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 |
| CAS Registry Number | 941-70-8 |
| SMILES | CC1(CC(C(C(C1)=O)C(N)=O)=O)C |
| InChI | 1S/C9H13NO3/c1-9(2)3-5(11)7(8(10)13)6(12)4-9/h7H,3-4H2,1-2H3,(H2,10,13) |
| InChIKey | CXYHFBSJWRHKML-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.111°C at 760 mmHg (Cal.) |
| Flash point | 202.433°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Carbamoyl-5,5-dimethyl-1,4-hexanedione |