|
CAS#: 94108-15-3 Product: 2-Chloro-N-Methyl-6-Nitrobenzylamine No suppilers available for the product. |
| Name | 2-Chloro-N-Methyl-6-Nitrobenzylamine |
|---|---|
| Synonyms | N-[(2-Chloro-6-Nitro-Phenyl)Methyl]Methanamine; (2-Chloro-6-Nitro-Benzyl)-Methyl-Amine; 2-Chloro-N-Methyl-6-Nitrobenzylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62 |
| CAS Registry Number | 94108-15-3 |
| EINECS | 302-353-9 |
| SMILES | C1=C([N+]([O-])=O)C(=C(Cl)C=C1)CNC |
| InChI | 1S/C8H9ClN2O2/c1-10-5-6-7(9)3-2-4-8(6)11(12)13/h2-4,10H,5H2,1H3 |
| InChIKey | KLVFNRYOUGSYDE-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.31°C at 760 mmHg (Cal.) |
| Flash point | 119.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N-Methyl-6-Nitrobenzylamine |