|
CAS#: 94108-57-3 Product: (4-tert-Butyl-O-Tolyl)Acetaldehyde No suppilers available for the product. |
| Name | (4-tert-Butyl-O-Tolyl)Acetaldehyde |
|---|---|
| Synonyms | 2-(4-Tert-Butyl-2-Methyl-Phenyl)Acetaldehyde; 2-(4-Tert-Butyl-2-Methyl-Phenyl)Ethanal; (4-Tert-Butyl-O-Tolyl)Acetaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 94108-57-3 |
| EINECS | 302-398-4 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1C)CC=O |
| InChI | 1S/C13H18O/c1-10-9-12(13(2,3)4)6-5-11(10)7-8-14/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | ACGSLLPQEVTPIJ-UHFFFAOYSA-N |
| Density | 0.94g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.794°C at 760 mmHg (Cal.) |
| Flash point | 124.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-tert-Butyl-O-Tolyl)Acetaldehyde |