|
CAS#: 94109-80-5 Product: Methyl 8-ethyl-2-methoxy-5-oxo-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-6-carboxylate No suppilers available for the product. |
| Name | Methyl 8-ethyl-2-methoxy-5-oxo-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| Synonyms | methyl 8- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 94109-80-5 |
| EINECS | 302-520-6 |
| SMILES | COC(=O)C2CN(CC)c1nc(ncc1C2=O)OC |
| InChI | 1S/C12H15N3O4/c1-4-15-6-8(11(17)18-2)9(16)7-5-13-12(19-3)14-10(7)15/h5,8H,4,6H2,1-3H3 |
| InChIKey | OLLMUVALDSVZFG-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.872°C at 760 mmHg (Cal.) |
| Flash point | 217.408°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 8-ethyl-2-methoxy-5-oxo-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-6-carboxylate |