|
CAS#: 94113-61-8 Product: 1-(4'-Bromo-4-biphenylyl)-1-(4-chlorophenyl)-2-propen-1-ol No suppilers available for the product. |
| Name | 1-(4'-Bromo-4-biphenylyl)-1-(4-chlorophenyl)-2-propen-1-ol |
|---|---|
| Synonyms | 4'-bromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H16BrClO |
| Molecular Weight | 399.71 |
| CAS Registry Number | 94113-61-8 |
| EINECS | 302-596-0 |
| SMILES | Brc1ccc(cc1)c2ccc(cc2)C(O)(C=C)c3ccc(Cl)cc3 |
| InChI | 1S/C21H16BrClO/c1-2-21(24,18-9-13-20(23)14-10-18)17-7-3-15(4-8-17)16-5-11-19(22)12-6-16/h2-14,24H,1H2 |
| InChIKey | GNDXHAOQVVNPNN-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.774°C at 760 mmHg (Cal.) |
| Flash point | 266.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4'-Bromo-4-biphenylyl)-1-(4-chlorophenyl)-2-propen-1-ol |