|
CAS#: 94133-65-0 Product: Methyl 1,3-Dichloro-6-(Trifluoromethyl)Phenanthren-9-Carboxylate No suppilers available for the product. |
| Name | Methyl 1,3-Dichloro-6-(Trifluoromethyl)Phenanthren-9-Carboxylate |
|---|---|
| Synonyms | methyl 1, |
| Molecular Structure | ![]() |
| Molecular Formula | C17H9Cl2F3O2 |
| Molecular Weight | 373.15 |
| CAS Registry Number | 94133-65-0 |
| EINECS | 302-727-1 |
| SMILES | FC(F)(F)c2ccc3c(cc1c(Cl)cc(Cl)cc1c3c2)C(=O)OC |
| InChI | 1S/C17H9Cl2F3O2/c1-24-16(23)14-7-13-12(5-9(18)6-15(13)19)11-4-8(17(20,21)22)2-3-10(11)14/h2-7H,1H3 |
| InChIKey | AIKJZSWXLMBBJK-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.925°C at 760 mmHg (Cal.) |
| Flash point | 185.688°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1,3-Dichloro-6-(Trifluoromethyl)Phenanthren-9-Carboxylate |