|
CAS#: 94134-19-7 Product: 1,1-Dimethylbiguanide Citrate No suppilers available for the product. |
| Name | 1,1-Dimethylbiguanide Citrate |
|---|---|
| Synonyms | 3-(Diaminomethylene)-1,1-Dimethyl-Guanidine Citrate; 3-(Diaminomethylene)-1,1-Dimethylguanidine Citrate; 3-(Diaminomethylidene)-1,1-Dimethyl-Guanidine; 2-Hydroxypropane-1,2,3-Tricarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N5O7 |
| Molecular Weight | 318.27 |
| CAS Registry Number | 94134-19-7 |
| EINECS | 302-786-3 |
| SMILES | C(C(O)(CC([O-])=O)C([O-])=O)C([O-])=O.CN(C)C(N=C(N)N)=N |
| InChI | 1S/C6H8O7.C4H11N5/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-9(2)4(7)8-3(5)6/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H3,(H5,5,6,7,8)/p-3 |
| InChIKey | AFIHOTTTWXQFDO-UHFFFAOYSA-K |
| Boiling point | 309.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dimethylbiguanide Citrate |