|
CAS#: 94135-13-4 Product: Tris(m-Hydroxyphenyl) Phosphate No suppilers available for the product. |
| Name | Tris(m-Hydroxyphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(3-Hydroxyphenyl) Ester; Tris(M-Hydroxyphenyl) Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15O7P |
| Molecular Weight | 374.29 |
| CAS Registry Number | 94135-13-4 |
| EINECS | 302-882-5 |
| SMILES | C1=C(O)C=CC=C1O[P](OC2=CC=CC(=C2)O)(OC3=CC(=CC=C3)O)=O |
| InChI | 1S/C18H15O7P/c19-13-4-1-7-16(10-13)23-26(22,24-17-8-2-5-14(20)11-17)25-18-9-3-6-15(21)12-18/h1-12,19-21H |
| InChIKey | GGYSSENSJNGXLU-UHFFFAOYSA-N |
| Density | 1.478g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.921°C at 760 mmHg (Cal.) |
| Flash point | 281.544°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(m-Hydroxyphenyl) Phosphate |