|
CAS#: 94135-99-6 Product: N-[4-(Aminomethyl)Phenyl]Benzenesulphonamide Monohydrochloride No suppilers available for the product. |
| Name | N-[4-(Aminomethyl)Phenyl]Benzenesulphonamide Monohydrochloride |
|---|---|
| Synonyms | N-(4-(Aminomethyl)Phenyl)Benzenesulphonamide Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.79 |
| CAS Registry Number | 94135-99-6 |
| EINECS | 302-971-9 |
| SMILES | [H+].C2=C(N[S](=O)(=O)C1=CC=CC=C1)C=CC(=C2)CN.[Cl-] |
| InChI | 1S/C13H14N2O2S.ClH/c14-10-11-6-8-12(9-7-11)15-18(16,17)13-4-2-1-3-5-13;/h1-9,15H,10,14H2;1H |
| InChIKey | DPFVUKKSEKESLJ-UHFFFAOYSA-N |
| Boiling point | 441.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 220.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(Aminomethyl)Phenyl]Benzenesulphonamide Monohydrochloride |