|
CAS#: 94136-02-4 Product: 1,2-Dichloro-N4-ethyl-2,5-cyclohexadiene-1,4-diamine hydrochloride (1:1) No suppilers available for the product. |
| Name | 1,2-Dichloro-N4-ethyl-2,5-cyclohexadiene-1,4-diamine hydrochloride (1:1) |
|---|---|
| Synonyms | 4,5-dichloro-N-ethylbenzene-1,4-diamine hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13Cl3N2 |
| Molecular Weight | 243.56 |
| CAS Registry Number | 94136-02-4 |
| EINECS | 302-975-0 |
| SMILES | Cl.ClC1(N)C=CC(C=C1Cl)NCC |
| InChI | 1S/C8H12Cl2N2.ClH/c1-2-12-6-3-4-8(10,11)7(9)5-6;/h3-6,12H,2,11H2,1H3;1H |
| InChIKey | DMPIIRZTWJXSSA-UHFFFAOYSA-N |
| Boiling point | 316.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloro-N4-ethyl-2,5-cyclohexadiene-1,4-diamine hydrochloride (1:1) |