|
CAS#: 94138-91-7 Product: Lithium (9Z,12Z,15Z)-9,12,15-Octadecatrienoate No suppilers available for the product. |
| Name | Lithium (9Z,12Z,15Z)-9,12,15-Octadecatrienoate |
|---|---|
| Synonyms | Lithium (9Z,12Z,15Z)-9,12,15-Octadecatrienoate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H29LiO2 |
| Molecular Weight | 284.37 |
| CAS Registry Number | 94138-91-7 |
| EINECS | 303-006-4 |
| SMILES | C(C([O-])=O)CCCCCC\C=C\C\C=C\C\C=C\CC.[Li+] |
| InChI | 1S/C18H30O2.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b4-3+,7-6+,10-9+; |
| InChIKey | DYWHQKKVLYASPF-ICUOVBAUSA-M |
| Boiling point | 443.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 275.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium (9Z,12Z,15Z)-9,12,15-Octadecatrienoate |