|
CAS#: 94157-93-4 Product: Ethyl 5-Oxopyrrolidine-2-Acetate No suppilers available for the product. |
| Name | Ethyl 5-Oxopyrrolidine-2-Acetate |
|---|---|
| Synonyms | 2-(1-Ethyl-5-Oxo-Pyrrolidin-2-Yl)Acetate; 2-(1-Ethyl-5-Oxo-2-Pyrrolidinyl)Acetate; 2-(1-Ethyl-5-Keto-Pyrrolidin-2-Yl)Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12NO3 |
| Molecular Weight | 170.19 |
| CAS Registry Number | 94157-93-4 |
| EINECS | 303-061-4 |
| SMILES | C(C1N(C(=O)CC1)CC)C([O-])=O |
| InChI | 1S/C8H13NO3/c1-2-9-6(5-8(11)12)3-4-7(9)10/h6H,2-5H2,1H3,(H,11,12)/p-1 |
| InChIKey | BABFDJDHGVJREU-UHFFFAOYSA-M |
| Boiling point | 377.42°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 182.057°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-Oxopyrrolidine-2-Acetate |