Online Database of Chemicals from Around the World
|
CAS#: 94158-76-6 Product: 4-(2-Methyl-1-Phenyl-1-Butenyl)Toluene No suppilers available for the product. |
| Name | 4-(2-Methyl-1-Phenyl-1-Butenyl)Toluene |
|---|---|
| Synonyms | 1-Methyl-4-[(Z)-2-Methyl-1-Phenyl-But-1-Enyl]Benzene; P-(2-Methyl-1-Phenyl-1-Butenyl)Toluene |
| Molecular Structure |  |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 |
| CAS Registry Number | 94158-76-6 |
| EINECS | 303-149-2 |
| SMILES | C2=C(\C(C1=CC=CC=C1)=C(/CC)C)C=CC(=C2)C |
| InChI | 1S/C18H20/c1-4-15(3)18(16-8-6-5-7-9-16)17-12-10-14(2)11-13-17/h5-13H,4H2,1-3H3/b18-15- |
| InChIKey | LNJCJKLAEPHDJQ-SDXDJHTJSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.903°C at 760 mmHg (Cal.) |
| Flash point | 163.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Methyl-1-Phenyl-1-Butenyl)Toluene |