|
CAS#: 94159-39-4 Product: 1,2-Ethanediyl bis(tribromoacetate) No suppilers available for the product. |
| Name | 1,2-Ethanediyl bis(tribromoacetate) |
|---|---|
| Synonyms | ethylene bis(tribromoacetate) |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4Br6O4 |
| Molecular Weight | 619.52 |
| CAS Registry Number | 94159-39-4 |
| EINECS | 303-218-7 |
| SMILES | O=C(OCCOC(=O)C(Br)(Br)Br)C(Br)(Br)Br |
| InChI | 1S/C6H4Br6O4/c7-5(8,9)3(13)15-1-2-16-4(14)6(10,11)12/h1-2H2 |
| InChIKey | AZEYOLLKUUMOHW-UHFFFAOYSA-N |
| Density | 2.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.313°C at 760 mmHg (Cal.) |
| Flash point | 213.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Ethanediyl bis(tribromoacetate) |