Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1-(Ethenyloxy)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-2-Undecanol |
|---|---|
| Synonyms | 1-Ethenoxy-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-Undecan-2-Ol; 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-(Vinyloxy)Undecan-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C13H9F17O2 |
| Molecular Weight | 520.19 |
| CAS Registry Number | 94159-86-1 |
| EINECS | 303-267-4 |
| SMILES | C(OC=C)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C13H9F17O2/c1-2-32-4-5(31)3-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h2,5,31H,1,3-4H2 |
| InChIKey | XLLVATUSJHKQQF-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.048°C at 760 mmHg (Cal.) |
| Flash point | 125.955°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Ethenyloxy)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-2-Undecanol |