Online Database of Chemicals from Around the World
|
CAS#: 94159-91-8 Product: 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-Phenoxyundecan-2-Ol No suppilers available for the product. |
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-Phenoxyundecan-2-Ol |
|---|---|
| Synonyms | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-Phenoxyundecan-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C17H11F17O2 |
| Molecular Weight | 570.25 |
| CAS Registry Number | 94159-91-8 |
| EINECS | 303-273-7 |
| SMILES | C1=C(OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=CC=C1 |
| InChI | 1S/C17H11F17O2/c18-10(19,6-8(35)7-36-9-4-2-1-3-5-9)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h1-5,8,35H,6-7H2 |
| InChIKey | LXBFURBCWJWTTM-UHFFFAOYSA-N |
| Density | 1.544g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.739°C at 760 mmHg (Cal.) |
| Flash point | 157.268°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-Phenoxyundecan-2-Ol |