|
CAS#: 94166-83-3 Product: 1,3-diisocyanato-5-[(2-isocyanatophenyl)methyl]-2-methyl-benzene No suppilers available for the product. |
| Name | 1,3-diisocyanato-5-[(2-isocyanatophenyl)methyl]-2-methyl-benzene |
|---|---|
| Synonyms | 5-(o-isocyanatobenzyl)-2-methyl-m-phenylene diisocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11N3O3 |
| Molecular Weight | 305.29 |
| CAS Registry Number | 94166-83-3 |
| EINECS | 303-381-4 |
| SMILES | O=C=Nc1cc(cc(N=C=O)c1C)Cc2ccccc2N=C=O |
| InChI | 1S/C17H11N3O3/c1-12-16(19-10-22)7-13(8-17(12)20-11-23)6-14-4-2-3-5-15(14)18-9-21/h2-5,7-8H,6H2,1H3 |
| InChIKey | GMRNPNMSFIZWBC-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.206°C at 760 mmHg (Cal.) |
| Flash point | 187.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-diisocyanato-5-[(2-isocyanatophenyl)methyl]-2-methyl-benzene |