|
CAS#: 941716-97-8 Product: 3-Bromo-2-(4-isocyanatophenyl)thiophene No suppilers available for the product. |
| Name | 3-Bromo-2-(4-isocyanatophenyl)thiophene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H6BrNOS |
| Molecular Weight | 280.14 |
| CAS Registry Number | 941716-97-8 |
| SMILES | c1cc(ccc1c2c(ccs2)Br)N=C=O |
| InChI | 1S/C11H6BrNOS/c12-10-5-6-15-11(10)8-1-3-9(4-2-8)13-7-14/h1-6H |
| InChIKey | IJSMFPXVQGIORY-UHFFFAOYSA-N |
| Density | 1.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.837°C at 760 mmHg (Cal.) |
| Flash point | 159.933°C (Cal.) |
| Refractive index | 1.664 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2-(4-isocyanatophenyl)thiophene |