|
CAS#: 94200-68-7 Product: 3-(3-Chloro-2,4,6-Trinitrophenoxy)Phenol No suppilers available for the product. |
| Name | 3-(3-Chloro-2,4,6-Trinitrophenoxy)Phenol |
|---|---|
| Synonyms | 3-(3-Chloro-2,4,6-Trinitro-Phenoxy)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6ClN3O8 |
| Molecular Weight | 355.65 |
| CAS Registry Number | 94200-68-7 |
| EINECS | 303-547-6 |
| SMILES | C1=C([N+]([O-])=O)C(=C([N+]([O-])=O)C(=C1[N+]([O-])=O)Cl)OC2=CC=CC(=C2)O |
| InChI | 1S/C12H6ClN3O8/c13-10-8(14(18)19)5-9(15(20)21)12(11(10)16(22)23)24-7-3-1-2-6(17)4-7/h1-5,17H |
| InChIKey | APCPHDKQTSPRBK-UHFFFAOYSA-N |
| Density | 1.727g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.546°C at 760 mmHg (Cal.) |
| Flash point | 232.935°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Chloro-2,4,6-Trinitrophenoxy)Phenol |