|
CAS#: 94201-42-0 Product: [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-bromoacetate No suppilers available for the product. |
| Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-bromoacetate |
|---|---|
| Synonyms | D-glucitol 1-(bromoacetate) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15BrO7 |
| Molecular Weight | 303.10 |
| CAS Registry Number | 94201-42-0 |
| EINECS | 303-628-6 |
| SMILES | O[C@H]([C@@H](O)COC(=O)CBr)[C@H](O)[C@H](O)CO |
| InChI | 1S/C8H15BrO7/c9-1-6(13)16-3-5(12)8(15)7(14)4(11)2-10/h4-5,7-8,10-12,14-15H,1-3H2/t4-,5+,7-,8-/m1/s1 |
| InChIKey | AAXYNEPPTOVSSR-IXROVEORSA-N |
| Density | 1.823g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.24°C at 760 mmHg (Cal.) |
| Flash point | 300.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-bromoacetate |